C6H7BrO3 — CID 101060813
(1S,5R,6S,7S)-7-bromo-6-hydroxy-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 101060813) has the molecular formula C6H7BrO3 and a molecular weight of 207.02 g/mol. Its IUPAC name is (1S,5R,6S,7S)-7-bromo-6-hydroxy-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1S,5R,6S,7S)-7-bromo-6-hydroxy-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 101060813 |
| Molecular Formula | C6H7BrO3 |
| Molecular Weight | 207.02 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | (1S,5R,6S,7S)-7-bromo-6-hydroxy-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | O=C1OC[C@@H]2[C@H](O)[C@@H](Br)[C@H]12 |
| InChI | InChI=1S/C6H7BrO3/c7-4-3-2(5(4)8)1-10-6(3)9/h2-5,8H,1H2/t2-,3+,4-,5-/m0/s1 |
| InChIKey | BKABFSAMXLGLMU-QTBDOELSSA-N |
| XLogP | -0.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.02 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|