C9H12O5 — CID 129406676
(1S,2S,6R,7S,8R,9R)-9-hydroxy-8-methoxy-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 129406676) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (1S,2S,6R,7S,8R,9R)-9-hydroxy-8-methoxy-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1S,2S,6R,7S,8R,9R)-9-hydroxy-8-methoxy-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 129406676 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (1S,2S,6R,7S,8R,9R)-9-hydroxy-8-methoxy-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | CO[C@@H]1[C@H](O)[C@H]2O[C@H]1[C@H]1COC(=O)[C@@H]12 |
| InChI | InChI=1S/C9H12O5/c1-12-8-5(10)7-4-3(6(8)14-7)2-13-9(4)11/h3-8,10H,2H2,1H3/t3-,4-,5+,6-,7-,8+/m0/s1 |
| InChIKey | UVGOPEKTTRTMIW-IXEAHQSFSA-N |
| XLogP | -1.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |