About (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one
(1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 98044810) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
Analyze (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
The IUPAC name of (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (CID 98044810) is (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
What is the SMILES notation for (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
The canonical SMILES for (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one is O=C1OC[C@H]2[C@H]1[C@H]1CC[C@H]2O1.
What is the InChIKey of (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
The InChIKey is ZMBDOIYQGZHKEU-GBNDHIKLSA-N. The full InChI is InChI=1S/C8H10O3/c9-8-7-4(3-10-8)5-1-2-6(7)11-5/h4-7H,1-3H2/t4-,5-,6-,7+/m1/s1.
What are the key properties of (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
(1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one has a molecular weight of 154.16 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S,6R,7R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one is sourced from PubChem (CID 98044810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).