C38H58O10 — CID 20632546
5-O-tert-butyl 1-O-(9-methoxy-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20632546) has the molecular formula C38H58O10 and a molecular weight of 674.87 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-(9-methoxy-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-tert-butyl 1-O-(9-methoxy-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20632546 |
| Molecular Formula | C38H58O10 |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.40 |
| IUPAC Name | 5-O-tert-butyl 1-O-(9-methoxy-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC1C(OC)C2OC1C1C(=O)OCC21)C(=O)OC1(C)C2CC3CC(C2)CC1C3)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H58O10/c1-11-36(7,32(41)47-34(2,3)4)19-37(8,33(42)48-38(9)22-13-20-12-21(15-22)16-23(38)14-20)18-35(5,6)31(40)46-29-27-25-24(17-44-30(25)39)26(45-27)28(29)43-10/h20-29H,11-19H2,1-10H3 |
| InChIKey | PZCZIXJNMOXIMJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|