C28H46O7 — CID 23572043
1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 23572043) has the molecular formula C28H46O7 and a molecular weight of 494.67 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 23572043 |
| Molecular Formula | C28H46O7 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(2-methyl-2-adamantyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCCO)C(=O)OC1(C)C2CC3CC(C2)CC1C3)C(=O)OC |
| InChI | InChI=1S/C28H46O7/c1-8-26(4,23(31)33-7)17-27(5,16-25(2,3)22(30)34-10-9-29)24(32)35-28(6)20-12-18-11-19(14-20)15-21(28)13-18/h18-21,29H,8-17H2,1-7H3 |
| InChIKey | PJYUKGOYZSAFIG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|