C36H54O8 — CID 58520271
bis[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 58520271) has the molecular formula C36H54O8 and a molecular weight of 614.82 g/mol. Its IUPAC name is bis[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | bis[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58520271 |
| Molecular Formula | C36H54O8 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | bis[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(=O)OC1(C)C2CC3CC(C2)CC1C3)C(=O)OCC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C36H54O8/c1-7-34(4,32(40)42-19-30(38)44-36(6)27-14-23-9-24(16-27)17-28(36)15-23)20-33(2,3)31(39)41-18-29(37)43-35(5)25-10-21-8-22(12-25)13-26(35)11-21/h21-28H,7-20H2,1-6H3 |
| InChIKey | NKYMLSBZKKHGPP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|