C42H64O11 — CID 20632538
6-(1-adamantyloxycarbonyl)-2-ethyl-9-[(9-methoxy-5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2,4,6,8,8-pentamethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxononanoic acid (PubChem CID 20632538) has the molecular formula C42H64O11 and a molecular weight of 744.96 g/mol. Its IUPAC name is 6-(1-adamantyloxycarbonyl)-2-ethyl-9-[(9-methoxy-5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2,4,6,8,8-pentamethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxononanoic acid.
| Compound Name | 6-(1-adamantyloxycarbonyl)-2-ethyl-9-[(9-methoxy-5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2,4,6,8,8-pentamethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxononanoic acid |
|---|---|
| PubChem CID | 20632538 |
| Molecular Formula | C42H64O11 |
| Molecular Weight | 744.96 g/mol |
| Exact Mass | 744.44 |
| IUPAC Name | 6-(1-adamantyloxycarbonyl)-2-ethyl-9-[(9-methoxy-5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2,4,6,8,8-pentamethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxononanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OC1C2CC(C3COC(=O)C32)C1OC)C(=O)OC12CC3CC(CC(C3)C1)C2)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C42H64O11/c1-11-39(7,33(44)45)21-41(9,35(47)52-37(2,3)4)22-40(8,36(48)53-42-16-23-12-24(17-42)14-25(13-23)18-42)20-38(5,6)34(46)51-31-27-15-26(30(31)49-10)28-19-50-32(43)29(27)28/h23-31H,11-22H2,1-10H3,(H,44,45) |
| InChIKey | LFCLKPBPDNWBLP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.96 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|