C25H52O3Si3 — CID 132916381
(2R,6aR)-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-trimethylsilyl-2,4,6,6a-tetrahydro-1H-pentalen-2-ol (PubChem CID 132916381) has the molecular formula C25H52O3Si3 and a molecular weight of 484.95 g/mol. Its IUPAC name is (2R,6aR)-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-trimethylsilyl-2,4,6,6a-tetrahydro-1H-pentalen-2-ol.
| Compound Name | (2R,6aR)-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-trimethylsilyl-2,4,6,6a-tetrahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 132916381 |
| Molecular Formula | C25H52O3Si3 |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (2R,6aR)-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-trimethylsilyl-2,4,6,6a-tetrahydro-1H-pentalen-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CO[Si](C)(C)C(C)(C)C)CC2=C([Si](C)(C)C)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C25H52O3Si3/c1-23(2,3)30(10,11)27-17-25(18-28-31(12,13)24(4,5)6)15-19-14-21(26)22(20(19)16-25)29(7,8)9/h19,21,26H,14-18H2,1-13H3/t19-,21+/m0/s1 |
| InChIKey | CBSQKTWIKUSNSE-PZJWPPBQSA-N |
| XLogP | 7.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|