C21H36O2Si — CID 102366997
(3aS,4R,5aS,9S)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-1,2,3,4,5,5a,8,9-octahydrocyclopenta[i]inden-9-ol (PubChem CID 102366997) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (3aS,4R,5aS,9S)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-1,2,3,4,5,5a,8,9-octahydrocyclopenta[i]inden-9-ol.
| Compound Name | (3aS,4R,5aS,9S)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-1,2,3,4,5,5a,8,9-octahydrocyclopenta[i]inden-9-ol |
|---|---|
| PubChem CID | 102366997 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (3aS,4R,5aS,9S)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-1,2,3,4,5,5a,8,9-octahydrocyclopenta[i]inden-9-ol |
| SMILES | C=C[C@H]1C[C@H]2C=CC[C@H](O)C23CCC[C@]13CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-7-16-14-17-10-8-11-18(22)21(17)13-9-12-20(16,21)15-23-24(5,6)19(2,3)4/h7-8,10,16-18,22H,1,9,11-15H2,2-6H3/t16-,17+,18-,20-,21?/m0/s1 |
| InChIKey | CMHNVKFAIGVCTR-PRKQWTSCSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|