C25H40O3Si — CID 150471804
(9S,10R,13S,14S,16R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-16-hydroxy-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 150471804) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is (9S,10R,13S,14S,16R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-16-hydroxy-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (9S,10R,13S,14S,16R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-16-hydroxy-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 150471804 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (9S,10R,13S,14S,16R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-16-hydroxy-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12CC[C@H]3C(=CC=C4CCCC[C@@]43C)[C@@H]1C[C@@H](O)C2=O |
| InChI | InChI=1S/C25H40O3Si/c1-23(2,3)29(5,6)28-16-25-14-12-19-18(20(25)15-21(26)22(25)27)11-10-17-9-7-8-13-24(17,19)4/h10-11,19-21,26H,7-9,12-16H2,1-6H3/t19-,20-,21+,24-,25+/m0/s1 |
| InChIKey | HRYJZLGYQSIVGA-NEWSNEBISA-N |
| XLogP | 5.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|