C27H44O2Si — CID 173319826
(9S,10R,13S,14S)-13-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 173319826) has the molecular formula C27H44O2Si and a molecular weight of 428.73 g/mol. Its IUPAC name is (9S,10R,13S,14S)-13-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (9S,10R,13S,14S)-13-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 173319826 |
| Molecular Formula | C27H44O2Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (9S,10R,13S,14S)-13-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-10-methyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)C(C)(C)C(O[SiH](C)C)[C@]12CC[C@H]3C(=CC=C4CCCC[C@@]43C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C27H44O2Si/c1-18(2)25(3,4)24(29-30(6)7)27-17-15-21-20(22(27)13-14-23(27)28)12-11-19-10-8-9-16-26(19,21)5/h11-12,18,21-22,24,30H,8-10,13-17H2,1-7H3/t21-,22-,24?,26-,27+/m0/s1 |
| InChIKey | JQDCHLUIFIKUQC-OHEGCTSYSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|