C33H58O3Si2 — CID 86752998
(1S,3R,9S,10R,13S,14S)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-10,13-dimethyl-1-triethylsilyloxy-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 86752998) has the molecular formula C33H58O3Si2 and a molecular weight of 559.00 g/mol. Its IUPAC name is (1S,3R,9S,10R,13S,14S)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-10,13-dimethyl-1-triethylsilyloxy-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (1S,3R,9S,10R,13S,14S)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-10,13-dimethyl-1-triethylsilyloxy-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 86752998 |
| Molecular Formula | C33H58O3Si2 |
| Molecular Weight | 559.00 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | (1S,3R,9S,10R,13S,14S)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-10,13-dimethyl-1-triethylsilyloxy-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C(C)C)CC2=CC=C3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@]21C |
| InChI | InChI=1S/C33H58O3Si2/c1-12-38(13-2,14-3)36-30-22-25(35-37(10,11)31(6,7)23(4)5)21-24-15-16-26-27-17-18-29(34)32(27,8)20-19-28(26)33(24,30)9/h15-16,23,25,27-28,30H,12-14,17-22H2,1-11H3/t25-,27+,28+,30+,32+,33+/m1/s1 |
| InChIKey | ALCZPKAFGVBQBX-OBFVSYLISA-N |
| XLogP | 9.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.00 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|