C38H68O4Si2 — CID 70007160
4-[1-[(9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-2-methylbutan-2-ol (PubChem CID 70007160) has the molecular formula C38H68O4Si2 and a molecular weight of 645.13 g/mol. Its IUPAC name is 4-[1-[(9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-2-methylbutan-2-ol.
| Compound Name | 4-[1-[(9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 70007160 |
| Molecular Formula | C38H68O4Si2 |
| Molecular Weight | 645.13 g/mol |
| Exact Mass | 644.47 |
| IUPAC Name | 4-[1-[(9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-2-methylbutan-2-ol |
| SMILES | CC(OCCC(C)(C)O)C1=CC[C@H]2C3=CC=C4CC(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C38H68O4Si2/c1-26(40-23-22-36(8,9)39)30-18-19-31-29-17-16-27-24-28(41-43(12,13)34(2,3)4)25-33(42-44(14,15)35(5,6)7)38(27,11)32(29)20-21-37(30,31)10/h16-18,26,28,31-33,39H,19-25H2,1-15H3/t26?,28?,31-,32-,33?,37+,38-/m0/s1 |
| InChIKey | GGJRYXJODPJOFQ-GBPDEIEDSA-N |
| XLogP | 10.36 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.13 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|