C35H60O3SSi — CID 70008626
(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-[1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 70008626) has the molecular formula C35H60O3SSi and a molecular weight of 589.02 g/mol. Its IUPAC name is (9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-[1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-[1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 70008626 |
| Molecular Formula | C35H60O3SSi |
| Molecular Weight | 589.02 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | (9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-[1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(O)(CC)CCCSC(C)C1=CC[C@H]2C3=CC=C4CC(O)CC(O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H60O3SSi/c1-11-35(37,12-2)19-13-21-39-24(3)28-16-17-29-27-15-14-25-22-26(36)23-31(38-40(9,10)32(4,5)6)34(25,8)30(27)18-20-33(28,29)7/h14-16,24,26,29-31,36-37H,11-13,17-23H2,1-10H3/t24?,26?,29-,30-,31?,33+,34-/m0/s1 |
| InChIKey | XVAHKZOZZBRTHI-AJFAHMBLSA-N |
| XLogP | 9.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.02 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|