C25H38O3S — CID 12019522
(1S,3R,9S,10R,13S,14S)-17-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 12019522) has the molecular formula C25H38O3S and a molecular weight of 418.64 g/mol. Its IUPAC name is (1S,3R,9S,10R,13S,14S)-17-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1S,3R,9S,10R,13S,14S)-17-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 12019522 |
| Molecular Formula | C25H38O3S |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (1S,3R,9S,10R,13S,14S)-17-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | C[C@H](SCC(C)(C)O)C1=CC[C@H]2C3=CC=C4C[C@@H](O)C[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38O3S/c1-15(29-14-23(2,3)28)19-8-9-20-18-7-6-16-12-17(26)13-22(27)25(16,5)21(18)10-11-24(19,20)4/h6-8,15,17,20-22,26-28H,9-14H2,1-5H3/t15-,17+,20-,21-,22-,24+,25-/m0/s1 |
| InChIKey | CPUGOIFVYFHISR-SZYCNBCGSA-N |
| XLogP | 4.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|