C25H37NO4 — CID 59537260
2-[(1S)-1-[(1S,3R,10R,13S)-1,3-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-N-ethylacetamide (PubChem CID 59537260) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-[(1S)-1-[(1S,3R,10R,13S)-1,3-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-N-ethylacetamide.
| Compound Name | 2-[(1S)-1-[(1S,3R,10R,13S)-1,3-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 59537260 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 2-[(1S)-1-[(1S,3R,10R,13S)-1,3-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)CO[C@@H](C)C1=CCC2C3=CC=C4C[C@@H](O)C[C@H](O)[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C25H37NO4/c1-5-26-23(29)14-30-15(2)19-8-9-20-18-7-6-16-12-17(27)13-22(28)25(16,4)21(18)10-11-24(19,20)3/h6-8,15,17,20-22,27-28H,5,9-14H2,1-4H3,(H,26,29)/t15-,17+,20?,21?,22-,24+,25-/m0/s1 |
| InChIKey | SRMQXKJVULDNDJ-NFJQRBEMSA-N |
| XLogP | 3.28 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|