C27H40O4 — CID 70008400
(1S,3R,9S,10R,13S,14S)-17-[(1R)-1-[(Z)-4-hydroxy-4-methylpent-2-enoxy]ethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 70008400) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is (1S,3R,9S,10R,13S,14S)-17-[(1R)-1-[(Z)-4-hydroxy-4-methylpent-2-enoxy]ethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1S,3R,9S,10R,13S,14S)-17-[(1R)-1-[(Z)-4-hydroxy-4-methylpent-2-enoxy]ethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 70008400 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (1S,3R,9S,10R,13S,14S)-17-[(1R)-1-[(Z)-4-hydroxy-4-methylpent-2-enoxy]ethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | C[C@@H](OC/C=C\C(C)(C)O)C1=CC[C@H]2C3=CC=C4C[C@@H](O)C[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H40O4/c1-17(31-14-6-12-25(2,3)30)21-9-10-22-20-8-7-18-15-19(28)16-24(29)27(18,5)23(20)11-13-26(21,22)4/h6-9,12,17,19,22-24,28-30H,10-11,13-16H2,1-5H3/b12-6-/t17-,19-,22+,23+,24+,26-,27+/m1/s1 |
| InChIKey | FAFMDBBMJVCFRV-AANGLTRRSA-N |
| XLogP | 4.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|