C39H70O3Si2 — CID 12020964
(6S)-6-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol (PubChem CID 12020964) has the molecular formula C39H70O3Si2 and a molecular weight of 643.16 g/mol. Its IUPAC name is (6S)-6-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol.
| Compound Name | (6S)-6-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 12020964 |
| Molecular Formula | C39H70O3Si2 |
| Molecular Weight | 643.16 g/mol |
| Exact Mass | 642.49 |
| IUPAC Name | (6S)-6-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol |
| SMILES | C[C@@H](CCCC(C)(C)O)C1=CC[C@H]2C3=CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C39H70O3Si2/c1-27(17-16-23-37(8,9)40)31-20-21-32-30-19-18-28-25-29(41-43(12,13)35(2,3)4)26-34(42-44(14,15)36(5,6)7)39(28,11)33(30)22-24-38(31,32)10/h18-20,27,29,32-34,40H,16-17,21-26H2,1-15H3/t27-,29+,32-,33-,34-,38+,39-/m0/s1 |
| InChIKey | RSNCRPOYKJHXDG-NPCFOWJXSA-N |
| XLogP | 11.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.16 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|