C32H55BrO2Si2 — CID 90992492
[(9S,10R,13S,14S)-17-(bromomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 90992492) has the molecular formula C32H55BrO2Si2 and a molecular weight of 607.87 g/mol. Its IUPAC name is [(9S,10R,13S,14S)-17-(bromomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(9S,10R,13S,14S)-17-(bromomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 90992492 |
| Molecular Formula | C32H55BrO2Si2 |
| Molecular Weight | 607.87 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | [(9S,10R,13S,14S)-17-(bromomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC2=CC=C3[C@@H]4CC=C(CBr)[C@@]4(C)CC[C@@H]3[C@@]2(C)C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H55BrO2Si2/c1-29(2,3)36(9,10)34-24-19-22-13-15-25-26-16-14-23(21-33)31(26,7)18-17-27(25)32(22,8)28(20-24)35-37(11,12)30(4,5)6/h13-15,24,26-28H,16-21H2,1-12H3/t24?,26-,27-,28?,31+,32-/m0/s1 |
| InChIKey | WZAFWUQZYRXOGP-URWLRULWSA-N |
| XLogP | 10.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.87 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|