C28H46O3S — CID 25099137
trans-(1R,3R)-5-[(2E)-2-[(7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol (PubChem CID 25099137) has the molecular formula C28H46O3S and a molecular weight of 462.74 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 25099137 |
| Molecular Formula | C28H46O3S |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol |
| SMILES | CCC(O)(CC)CCCS[C@@H](C)C1=CCC2/C(=C/C=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C28H46O3S/c1-5-28(31,6-2)15-8-16-32-20(3)25-12-13-26-22(9-7-14-27(25,26)4)11-10-21-17-23(29)19-24(30)18-21/h10-12,20,23-24,26,29-31H,5-9,13-19H2,1-4H3/b22-11+/t20-,23+,24+,26?,27+/m0/s1 |
| InChIKey | QZWWZSFUNUTAKT-STCYEHRISA-N |
| XLogP | 6.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|