C30H52O4S — CID 102175050
(3R)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethyl)cyclohexane-1,3-diol (PubChem CID 102175050) has the molecular formula C30H52O4S and a molecular weight of 508.81 g/mol. Its IUPAC name is (3R)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethyl)cyclohexane-1,3-diol.
| Compound Name | (3R)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethyl)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 102175050 |
| Molecular Formula | C30H52O4S |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | (3R)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1S)-1-(4-ethyl-4-hydroxyhexyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethyl)cyclohexane-1,3-diol |
| SMILES | CCC(O)(CC)CCCS[C@@H](C)[C@H]1CC[C@H]2/C(=C/C=C3\CC(O)C(CCO)[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C30H52O4S/c1-5-30(34,6-2)16-8-18-35-21(3)25-12-13-26-23(9-7-15-29(25,26)4)11-10-22-19-27(32)24(14-17-31)28(33)20-22/h10-11,21,24-28,31-34H,5-9,12-20H2,1-4H3/b22-10-,23-11+/t21-,24?,25+,26-,27+,28?,29+/m0/s1 |
| InChIKey | GMCCMVLDEMCOLZ-TURIKFGZSA-N |
| XLogP | 6.02 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|