C31H56O5S — CID 143286988
ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;propan-1-ol (PubChem CID 143286988) has the molecular formula C31H56O5S and a molecular weight of 540.85 g/mol. Its IUPAC name is ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;propan-1-ol.
| Compound Name | ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;propan-1-ol |
|---|---|
| PubChem CID | 143286988 |
| Molecular Formula | C31H56O5S |
| Molecular Weight | 540.85 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;propan-1-ol |
| SMILES | CCC(O)(CC)CS[C@H](C)C1=CCC2/C(=C/C=C3/CCC[C@H](O)C3)CCCC12C.CCCO.OCCO |
| InChI | InChI=1S/C26H42O2S.C3H8O.C2H6O2/c1-5-26(28,6-2)18-29-19(3)23-14-15-24-21(10-8-16-25(23,24)4)13-12-20-9-7-11-22(27)17-20;1-2-3-4;3-1-2-4/h12-14,19,22,24,27-28H,5-11,15-18H2,1-4H3;4H,2-3H2,1H3;3-4H,1-2H2/b20-12-,21-13+;;/t19-,22+,24?,25?;;/m1../s1 |
| InChIKey | WWWIIVADPDLRFA-UCLUMDHQSA-N |
| XLogP | 5.94 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.85 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|