C26H42O3S — CID 143286956
trans-(1R,3R)-5-[(2E)-2-[1-[(1S)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol (PubChem CID 143286956) has the molecular formula C26H42O3S and a molecular weight of 434.69 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[1-[(1S)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[1-[(1S)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 143286956 |
| Molecular Formula | C26H42O3S |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[1-[(1S)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol |
| SMILES | CCC(O)(CC)CS[C@@H](C)C1=CCC2/C(=C/C=C3C[C@@H](O)C[C@H](O)C3)CCCC12C |
| InChI | InChI=1S/C26H42O3S/c1-5-26(29,6-2)17-30-18(3)23-11-12-24-20(8-7-13-25(23,24)4)10-9-19-14-21(27)16-22(28)15-19/h9-11,18,21-22,24,27-29H,5-8,12-17H2,1-4H3/b20-10+/t18-,21+,22+,24?,25?/m0/s1 |
| InChIKey | QUDKCXJSFPLCSM-JXWVFHNUSA-N |
| XLogP | 5.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|