C27H44O5S — CID 102398376
trans-(1R,3R)-5-[(2E)-2-[(3aS,7aS)-1-[(1S)-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexane-1,3-diol (PubChem CID 102398376) has the molecular formula C27H44O5S and a molecular weight of 480.71 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(3aS,7aS)-1-[(1S)-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(3aS,7aS)-1-[(1S)-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 102398376 |
| Molecular Formula | C27H44O5S |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(3aS,7aS)-1-[(1S)-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexane-1,3-diol |
| SMILES | C[C@H](SCCC(C)(C)O)C1=CC[C@H]2/C(=C/C=C3C[C@@H](O)C(OCCO)[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C27H44O5S/c1-18(33-15-12-26(2,3)31)21-9-10-22-20(6-5-11-27(21,22)4)8-7-19-16-23(29)25(24(30)17-19)32-14-13-28/h7-9,18,22-25,28-31H,5-6,10-17H2,1-4H3/b19-7-,20-8+/t18-,22-,23+,24+,25?,27+/m0/s1 |
| InChIKey | HOIJYQANAHXGMO-FYFWEFDJSA-N |
| XLogP | 4.15 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|