C25H34O — CID 143647471
(1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(1-but-2-ynylcyclopropyl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 143647471) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(1-but-2-ynylcyclopropyl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(1-but-2-ynylcyclopropyl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143647471 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(1-but-2-ynylcyclopropyl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | CC#CCC1(C2=CC[C@H]3/C(=C/C=C4/CCC[C@H](O)C4)CCC[C@]23C)CC1 |
| InChI | InChI=1S/C25H34O/c1-3-4-15-25(16-17-25)23-13-12-22-20(8-6-14-24(22,23)2)11-10-19-7-5-9-21(26)18-19/h10-11,13,21-22,26H,5-9,12,14-18H2,1-2H3/b19-10-,20-11+/t21-,22-,24-/m0/s1 |
| InChIKey | JNNPRCSIILEWDM-SZJKFYDASA-N |
| XLogP | 6.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|