C29H48OSi — CID 10433395
2,3-dimethylbutan-2-yl-[[(3S,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane (PubChem CID 10433395) has the molecular formula C29H48OSi and a molecular weight of 440.79 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[[(3S,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane.
| Compound Name | 2,3-dimethylbutan-2-yl-[[(3S,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10433395 |
| Molecular Formula | C29H48OSi |
| Molecular Weight | 440.79 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[[(3S,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane |
| SMILES | C/C=C1/CC[C@H]2C3=CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H48OSi/c1-10-21-12-14-25-24-13-11-22-19-23(30-31(8,9)27(4,5)20(2)3)15-17-29(22,7)26(24)16-18-28(21,25)6/h10-11,13,20,23,25-26H,12,14-19H2,1-9H3/b21-10-/t23-,25-,26-,28+,29-/m0/s1 |
| InChIKey | VELQRLFTDBEBFW-ZKJOOXRWSA-N |
| XLogP | 8.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.79 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|