C32H56OSi — CID 59761007
[(3S,9S,10R,13R,14R,17R)-17-[(2S)-butan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 59761007) has the molecular formula C32H56OSi and a molecular weight of 484.89 g/mol. Its IUPAC name is [(3S,9S,10R,13R,14R,17R)-17-[(2S)-butan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3S,9S,10R,13R,14R,17R)-17-[(2S)-butan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 59761007 |
| Molecular Formula | C32H56OSi |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.41 |
| IUPAC Name | [(3S,9S,10R,13R,14R,17R)-17-[(2S)-butan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC[C@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H56OSi/c1-11-24(8)28-14-15-29-27-13-12-25-20-26(33-34(21(2)3,22(4)5)23(6)7)16-18-31(25,9)30(27)17-19-32(28,29)10/h12-13,21-24,26,28-30H,11,14-20H2,1-10H3/t24-,26-,28+,29-,30-,31-,32+/m0/s1 |
| InChIKey | QMLPIPVSPBTQJZ-VBNCKUHRSA-N |
| XLogP | 10.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|