C25H40O — CID 54331810
(9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-4-methylpentan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 54331810) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is (9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-4-methylpentan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-4-methylpentan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54331810 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | (9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-4-methylpentan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)C[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H40O/c1-16(2)14-17(3)21-8-9-22-20-7-6-18-15-19(26)10-12-24(18,4)23(20)11-13-25(21,22)5/h6-7,16-17,19,21-23,26H,8-15H2,1-5H3/t17-,19?,21-,22+,23+,24+,25-/m1/s1 |
| InChIKey | SYWACDOGEVOAMK-CBOQJABFSA-N |
| XLogP | 6.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |