C27H42O3 — CID 70182462
methyl (6R)-6-[(9S,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate (PubChem CID 70182462) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is methyl (6R)-6-[(9S,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate.
| Compound Name | methyl (6R)-6-[(9S,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate |
|---|---|
| PubChem CID | 70182462 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | methyl (6R)-6-[(9S,10R,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate |
| SMILES | COC(=O)CCCC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H42O3/c1-18(7-5-6-8-25(29)30-4)22-11-12-23-21-10-9-19-17-20(28)13-15-26(19,2)24(21)14-16-27(22,23)3/h9-10,18,20,22-24,28H,5-8,11-17H2,1-4H3/t18-,20?,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | XNSBKCVFSWLXDZ-CUEUGDGLSA-N |
| XLogP | 6.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|