C31H50O4 — CID 67607980
7-[(3S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]octyl acetate (PubChem CID 67607980) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is 7-[(3S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]octyl acetate.
| Compound Name | 7-[(3S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]octyl acetate |
|---|---|
| PubChem CID | 67607980 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 7-[(3S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]octyl acetate |
| SMILES | COCO[C@H]1CC[C@@]2(C)C(=CC=C3C2CC[C@]2(C)[C@@H](C(C)CCCCCCOC(C)=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H50O4/c1-22(10-8-6-7-9-19-34-23(2)32)27-13-14-28-26-12-11-24-20-25(35-21-33-5)15-17-30(24,3)29(26)16-18-31(27,28)4/h11-12,22,25,27-29H,6-10,13-21H2,1-5H3/t22?,25-,27+,28-,29?,30-,31+/m0/s1 |
| InChIKey | RETNYVBGOKOODM-WXYHBRBQSA-N |
| XLogP | 7.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|