C27H42O3 — CID 5379351
(E)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-ol (PubChem CID 5379351) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is (E)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-ol.
| Compound Name | (E)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-ol |
|---|---|
| PubChem CID | 5379351 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | (E)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-ol |
| SMILES | C/C=C/C(O)C(C)C1CCC2C3=CC=C4CC(OCOC)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C27H42O3/c1-6-7-25(28)18(2)22-10-11-23-21-9-8-19-16-20(30-17-29-5)12-14-26(19,3)24(21)13-15-27(22,23)4/h6-9,18,20,22-25,28H,10-17H2,1-5H3/b7-6+ |
| InChIKey | SZOCXHWISLUBPP-VOTSOKGWSA-N |
| XLogP | 6.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|