C28H44O4S — CID 57278086
[(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 57278086) has the molecular formula C28H44O4S and a molecular weight of 476.72 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 57278086 |
| Molecular Formula | C28H44O4S |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | [(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | CC(C)[C@@H](C)C=C[C@@H](C)[C@H]1CCC2C3=CC=C4C[C@@H](OS(=O)(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H44O4S/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(32-33(29,30)31)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18-20,22,24-26H,11-17H2,1-6H3,(H,29,30,31)/t19-,20+,22-,24+,25?,26?,27-,28+/m0/s1 |
| InChIKey | CBYSKJAGLYHZFJ-RYPLMELESA-N |
| XLogP | 7.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|