C37H50O2 — CID 66778677
[(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylprop-2-enoate (PubChem CID 66778677) has the molecular formula C37H50O2 and a molecular weight of 526.81 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylprop-2-enoate.
| Compound Name | [(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 66778677 |
| Molecular Formula | C37H50O2 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | [(3S,10R,13R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-phenylprop-2-enoate |
| SMILES | CC(C)[C@@H](C)C=C[C@@H](C)[C@H]1CCC2C3=CC=C4C[C@@H](OC(=O)C=Cc5ccccc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C37H50O2/c1-25(2)26(3)12-13-27(4)32-17-18-33-31-16-15-29-24-30(39-35(38)19-14-28-10-8-7-9-11-28)20-22-36(29,5)34(31)21-23-37(32,33)6/h7-16,19,25-27,30,32-34H,17-18,20-24H2,1-6H3/t26-,27+,30-,32+,33?,34?,36-,37+/m0/s1 |
| InChIKey | WXTJVZXYXTUEQZ-PKZMWZFCSA-N |
| XLogP | 9.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|