C29H46 — CID 20763018
17-[(E)-5,6-dimethylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 20763018) has the molecular formula C29H46 and a molecular weight of 394.69 g/mol. Its IUPAC name is 17-[(E)-5,6-dimethylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 17-[(E)-5,6-dimethylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 20763018 |
| Molecular Formula | C29H46 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | 17-[(E)-5,6-dimethylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC1CCC2(C)C(=CC=C3C2CCC2(C)C3CCC2C(C)/C=C/C(C)C(C)C)C1 |
| InChI | InChI=1S/C29H46/c1-19(2)21(4)8-9-22(5)25-12-13-26-24-11-10-23-18-20(3)14-16-28(23,6)27(24)15-17-29(25,26)7/h8-11,19-22,25-27H,12-18H2,1-7H3/b9-8+ |
| InChIKey | RWSNIMCJNVEZHV-CMDGGOBGSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|