C28H42O — CID 143725626
(E)-1-cyclopropyl-4-(3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)pent-2-en-1-ol (PubChem CID 143725626) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is (E)-1-cyclopropyl-4-(3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)pent-2-en-1-ol.
| Compound Name | (E)-1-cyclopropyl-4-(3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)pent-2-en-1-ol |
|---|---|
| PubChem CID | 143725626 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | (E)-1-cyclopropyl-4-(3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)pent-2-en-1-ol |
| SMILES | CC1CCC2(C)C(=CC=C3C2CCC2(C)C3CCC2C(C)/C=C/C(O)C2CC2)C1 |
| InChI | InChI=1S/C28H42O/c1-18-13-15-27(3)21(17-18)8-9-22-24-11-10-23(28(24,4)16-14-25(22)27)19(2)5-12-26(29)20-6-7-20/h5,8-9,12,18-20,23-26,29H,6-7,10-11,13-17H2,1-4H3/b12-5+ |
| InChIKey | KJTAHGOMSBMLEI-LFYBBSHMSA-N |
| XLogP | 7.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|