C31H50 — CID 142350114
17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-3-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 142350114) has the molecular formula C31H50 and a molecular weight of 422.74 g/mol. Its IUPAC name is 17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-3-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-3-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 142350114 |
| Molecular Formula | C31H50 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | 17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-3-propan-2-yl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)C(C)/C=C/C(C)C1CCC2C3=CC=C4CC(C(C)C)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C31H50/c1-20(2)22(5)9-10-23(6)27-13-14-28-26-12-11-25-19-24(21(3)4)15-17-30(25,7)29(26)16-18-31(27,28)8/h9-12,20-24,27-29H,13-19H2,1-8H3/b10-9+ |
| InChIKey | CBHWQZOHTXVXEC-MDZDMXLPSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|