C34H56O — CID 90797563
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(2-methylpentoxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 90797563) has the molecular formula C34H56O and a molecular weight of 480.82 g/mol. Its IUPAC name is 17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(2-methylpentoxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(2-methylpentoxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 90797563 |
| Molecular Formula | C34H56O |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.43 |
| IUPAC Name | 17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(2-methylpentoxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCC(C)COC1CCC2(C)C(=CC=C3C2CCC2(C)C3CCC2C(C)C=CC(C)C(C)C)C1 |
| InChI | InChI=1S/C34H56O/c1-9-10-24(4)22-35-28-17-19-33(7)27(21-28)13-14-29-31-16-15-30(34(31,8)20-18-32(29)33)26(6)12-11-25(5)23(2)3/h11-14,23-26,28,30-32H,9-10,15-22H2,1-8H3 |
| InChIKey | XMNABYYUCIYQKE-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|