C30H46O4 — CID 5379789
[(Z)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-yl] propanoate (PubChem CID 5379789) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is [(Z)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-yl] propanoate.
| Compound Name | [(Z)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-yl] propanoate |
|---|---|
| PubChem CID | 5379789 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | [(Z)-2-[3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-4-en-3-yl] propanoate |
| SMILES | C/C=C\C(OC(=O)CC)C(C)C1CCC2C3=CC=C4CC(OCOC)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C30H46O4/c1-7-9-27(34-28(31)8-2)20(3)24-12-13-25-23-11-10-21-18-22(33-19-32-6)14-16-29(21,4)26(23)15-17-30(24,25)5/h7,9-11,20,22,24-27H,8,12-19H2,1-6H3/b9-7- |
| InChIKey | LYMHJYJICDTQMI-CLFYSBASSA-N |
| XLogP | 7.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|