C35H54O6 — CID 10721779
[(3S,9S,10R,13R,14R,17R)-17-[(2S,3R,4R,5S)-3,4-diacetyloxy-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10721779) has the molecular formula C35H54O6 and a molecular weight of 570.81 g/mol. Its IUPAC name is [(3S,9S,10R,13R,14R,17R)-17-[(2S,3R,4R,5S)-3,4-diacetyloxy-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,9S,10R,13R,14R,17R)-17-[(2S,3R,4R,5S)-3,4-diacetyloxy-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10721779 |
| Molecular Formula | C35H54O6 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | [(3S,9S,10R,13R,14R,17R)-17-[(2S,3R,4R,5S)-3,4-diacetyloxy-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC[C@@H](C(C)C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H54O6/c1-10-27(20(2)3)33(41-24(7)38)32(40-23(6)37)21(4)29-13-14-30-28-12-11-25-19-26(39-22(5)36)15-17-34(25,8)31(28)16-18-35(29,30)9/h11-12,20-21,26-27,29-33H,10,13-19H2,1-9H3/t21-,26-,27-,29+,30-,31-,32+,33+,34-,35+/m0/s1 |
| InChIKey | IUILDXMGAWUWKJ-FOVYFZJRSA-N |
| XLogP | 7.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|