C31H52O5 — CID 139755658
(2S)-2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-ol (PubChem CID 139755658) has the molecular formula C31H52O5 and a molecular weight of 504.75 g/mol. Its IUPAC name is (2S)-2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-ol.
| Compound Name | (2S)-2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-ol |
|---|---|
| PubChem CID | 139755658 |
| Molecular Formula | C31H52O5 |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | (2S)-2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-ol |
| SMILES | COCO[C@@H]1CC2=CC=C3[C@@H]4CC[C@H]([C@H](C)C(O)CCC(C)C)[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@@H](OCOC)C1 |
| InChI | InChI=1S/C31H52O5/c1-20(2)8-13-28(32)21(3)25-11-12-26-24-10-9-22-16-23(35-18-33-6)17-29(36-19-34-7)31(22,5)27(24)14-15-30(25,26)4/h9-10,20-21,23,25-29,32H,8,11-19H2,1-7H3/t21-,23+,25+,26-,27-,28?,29-,30+,31-/m0/s1 |
| InChIKey | TZAASZYSARTAEY-HXQQMHQSSA-N |
| XLogP | 6.51 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|