C33H48O7S — CID 86746947
2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl 4-methylbenzenesulfonate (PubChem CID 86746947) has the molecular formula C33H48O7S and a molecular weight of 588.81 g/mol. Its IUPAC name is 2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86746947 |
| Molecular Formula | C33H48O7S |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 2-[(1S,3R,9S,10R,13R,14R,17R)-1,3-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl 4-methylbenzenesulfonate |
| SMILES | COCO[C@@H]1CC2=CC=C3[C@@H]4CC[C@H](C(C)COS(=O)(=O)c5ccc(C)cc5)[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@@H](OCOC)C1 |
| InChI | InChI=1S/C33H48O7S/c1-22-7-10-26(11-8-22)41(34,35)40-19-23(2)28-13-14-29-27-12-9-24-17-25(38-20-36-5)18-31(39-21-37-6)33(24,4)30(27)15-16-32(28,29)3/h7-12,23,25,28-31H,13-21H2,1-6H3/t23?,25-,28-,29+,30+,31+,32-,33+/m1/s1 |
| InChIKey | XNKFOGRLOAECKX-WRZLFILWSA-N |
| XLogP | 6.42 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|