C16H24O4S — CID 102165485
[(2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-methylcyclobutyl]propyl] 4-methylbenzenesulfonate (PubChem CID 102165485) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is [(2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-methylcyclobutyl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-methylcyclobutyl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102165485 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-methylcyclobutyl]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](C)[C@@H]2CC[C@@]2(C)CO)cc1 |
| InChI | InChI=1S/C16H24O4S/c1-12-4-6-14(7-5-12)21(18,19)20-10-13(2)15-8-9-16(15,3)11-17/h4-7,13,15,17H,8-11H2,1-3H3/t13-,15+,16+/m1/s1 |
| InChIKey | KYJINKIIWRDWEA-KBMXLJTQSA-N |
| XLogP | 2.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|