C29H48O5S — CID 71483561
[(2S)-2-[(1R,3aR,4S,7R,7aR)-4-hydroxy-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 71483561) has the molecular formula C29H48O5S and a molecular weight of 508.77 g/mol. Its IUPAC name is [(2S)-2-[(1R,3aR,4S,7R,7aR)-4-hydroxy-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(1R,3aR,4S,7R,7aR)-4-hydroxy-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71483561 |
| Molecular Formula | C29H48O5S |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | [(2S)-2-[(1R,3aR,4S,7R,7aR)-4-hydroxy-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](C)[C@H]2CC[C@H]3[C@@H](O)CC[C@@H](CCCCCCC(C)(C)O)[C@]23C)cc1 |
| InChI | InChI=1S/C29H48O5S/c1-21-11-14-24(15-12-21)35(32,33)34-20-22(2)25-16-17-26-27(30)18-13-23(29(25,26)5)10-8-6-7-9-19-28(3,4)31/h11-12,14-15,22-23,25-27,30-31H,6-10,13,16-20H2,1-5H3/t22-,23-,25-,26+,27+,29-/m1/s1 |
| InChIKey | GGNSGUJZJSVPNV-JRNXWWDNSA-N |
| XLogP | 6.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|