C28H56O3Si — CID 71481305
(1R,3aR,4S,7R,7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 71481305) has the molecular formula C28H56O3Si and a molecular weight of 468.84 g/mol. Its IUPAC name is (1R,3aR,4S,7R,7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7R,7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 71481305 |
| Molecular Formula | C28H56O3Si |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (1R,3aR,4S,7R,7aR)-1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7-(7-hydroxy-7-methyloctyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H](O)CC[C@@H](CCCCCCC(C)(C)O)[C@]12C |
| InChI | InChI=1S/C28H56O3Si/c1-21(20-31-32(8,9)26(2,3)4)23-16-17-24-25(29)18-15-22(28(23,24)7)14-12-10-11-13-19-27(5,6)30/h21-25,29-30H,10-20H2,1-9H3/t21-,22-,23-,24+,25+,28-/m1/s1 |
| InChIKey | MVIGFJORIGNJHN-BRMWOSQNSA-N |
| XLogP | 7.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|