C28H51FOSi — CID 67926895
tert-butyl-[2-[(8S,9S,10R,13S,14S,17R)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propoxy]-dimethylsilane (PubChem CID 67926895) has the molecular formula C28H51FOSi and a molecular weight of 450.80 g/mol. Its IUPAC name is tert-butyl-[2-[(8S,9S,10R,13S,14S,17R)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(8S,9S,10R,13S,14S,17R)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 67926895 |
| Molecular Formula | C28H51FOSi |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | tert-butyl-[2-[(8S,9S,10R,13S,14S,17R)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propoxy]-dimethylsilane |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CCC4C(F)CCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H51FOSi/c1-19(18-30-31(7,8)26(2,3)4)21-13-14-22-20-11-12-24-25(29)10-9-16-27(24,5)23(20)15-17-28(21,22)6/h19-25H,9-18H2,1-8H3/t19?,20-,21+,22-,23-,24?,25?,27+,28+/m0/s1 |
| InChIKey | FOKMGJNSCDKKNN-RJVFCTAKSA-N |
| XLogP | 8.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|