C30H54O3Si — CID 67926893
methyl (8R,9S,10S,13S,14S,17R)-17-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 67926893) has the molecular formula C30H54O3Si and a molecular weight of 490.85 g/mol. Its IUPAC name is methyl (8R,9S,10S,13S,14S,17R)-17-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (8R,9S,10S,13S,14S,17R)-17-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 67926893 |
| Molecular Formula | C30H54O3Si |
| Molecular Weight | 490.85 g/mol |
| Exact Mass | 490.38 |
| IUPAC Name | methyl (8R,9S,10S,13S,14S,17R)-17-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | COC(=O)C1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H](C(C)CO[Si](C)(C)C(C)(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H54O3Si/c1-20(19-33-34(8,9)28(2,3)4)24-12-13-25-23-11-10-22-18-21(27(31)32-7)14-16-29(22,5)26(23)15-17-30(24,25)6/h20-26H,10-19H2,1-9H3/t20?,21?,22?,23-,24+,25-,26-,29-,30+/m0/s1 |
| InChIKey | RXWOSBNFQJAKOW-NUPSMEFZSA-N |
| XLogP | 8.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.85 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|