C32H60OSi — CID 167569607
tert-butyl-dimethyl-[(4R)-4-[(3S,5S,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexoxy]silane (PubChem CID 167569607) has the molecular formula C32H60OSi and a molecular weight of 488.92 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R)-4-[(3S,5S,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(4R)-4-[(3S,5S,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexoxy]silane |
|---|---|
| PubChem CID | 167569607 |
| Molecular Formula | C32H60OSi |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.44 |
| IUPAC Name | tert-butyl-dimethyl-[(4R)-4-[(3S,5S,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexoxy]silane |
| SMILES | CC[C@H](CCCO[Si](C)(C)C(C)(C)C)[C@H]1CCC2C3CC[C@H]4C[C@@H](C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H60OSi/c1-10-24(12-11-21-33-34(8,9)30(3,4)5)27-15-16-28-26-14-13-25-22-23(2)17-19-31(25,6)29(26)18-20-32(27,28)7/h23-29H,10-22H2,1-9H3/t23-,24+,25-,26?,27+,28?,29?,31-,32+/m0/s1 |
| InChIKey | KOJDDWKBNJYRIN-LQKDWNQCSA-N |
| XLogP | 10.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|