C25H44O6S — CID 166497948
[(4S)-6-hydroxy-4-[(3S,5S,10S,13R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexyl] hydrogen sulfate (PubChem CID 166497948) has the molecular formula C25H44O6S and a molecular weight of 472.69 g/mol. Its IUPAC name is [(4S)-6-hydroxy-4-[(3S,5S,10S,13R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexyl] hydrogen sulfate.
| Compound Name | [(4S)-6-hydroxy-4-[(3S,5S,10S,13R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexyl] hydrogen sulfate |
|---|---|
| PubChem CID | 166497948 |
| Molecular Formula | C25H44O6S |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | [(4S)-6-hydroxy-4-[(3S,5S,10S,13R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexyl] hydrogen sulfate |
| SMILES | C[C@]12CCC3C(CC[C@H]4C[C@@H](O)CC[C@]34C)C1CCC2[C@H](CCO)CCCOS(=O)(=O)O |
| InChI | InChI=1S/C25H44O6S/c1-24-12-9-19(27)16-18(24)5-6-20-22-8-7-21(25(22,2)13-10-23(20)24)17(11-14-26)4-3-15-31-32(28,29)30/h17-23,26-27H,3-16H2,1-2H3,(H,28,29,30)/t17-,18-,19-,20?,21?,22?,23?,24-,25+/m0/s1 |
| InChIKey | SDSLJDLYBGHVMZ-OUVXGPRQSA-N |
| XLogP | 4.60 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|