C24H42O5S — CID 166497951
[(4R)-4-[(3S,5S,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] hydrogen sulfate (PubChem CID 166497951) has the molecular formula C24H42O5S and a molecular weight of 442.66 g/mol. Its IUPAC name is [(4R)-4-[(3S,5S,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] hydrogen sulfate.
| Compound Name | [(4R)-4-[(3S,5S,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] hydrogen sulfate |
|---|---|
| PubChem CID | 166497951 |
| Molecular Formula | C24H42O5S |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | [(4R)-4-[(3S,5S,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] hydrogen sulfate |
| SMILES | C[C@H](CCCOS(=O)(=O)O)[C@H]1CCC2C3CC[C@H]4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H42O5S/c1-16(5-4-14-29-30(26,27)28)20-8-9-21-19-7-6-17-15-18(25)10-12-23(17,2)22(19)11-13-24(20,21)3/h16-22,25H,4-15H2,1-3H3,(H,26,27,28)/t16-,17+,18+,19?,20-,21?,22?,23+,24-/m1/s1 |
| InChIKey | XQMRPCDUWBHCFI-JIEFMEPQSA-N |
| XLogP | 5.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|