C26H47O5P — CID 144822312
4-[(3R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl dimethyl phosphate (PubChem CID 144822312) has the molecular formula C26H47O5P and a molecular weight of 470.63 g/mol. Its IUPAC name is 4-[(3R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl dimethyl phosphate.
| Compound Name | 4-[(3R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl dimethyl phosphate |
|---|---|
| PubChem CID | 144822312 |
| Molecular Formula | C26H47O5P |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 4-[(3R,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl dimethyl phosphate |
| SMILES | COP(=O)(OC)OCCCC(C)C1CC[C@H]2C3CCC4C[C@H](O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H47O5P/c1-18(7-6-16-31-32(28,29-4)30-5)22-10-11-23-21-9-8-19-17-20(27)12-14-25(19,2)24(21)13-15-26(22,23)3/h18-24,27H,6-17H2,1-5H3/t18?,19?,20-,21?,22?,23+,24?,25?,26?/m1/s1 |
| InChIKey | JZDBBFHYUSKMNB-ZKFHMWLZSA-N |
| XLogP | 6.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|